C16H14N2O4 — CID 23992808
N-(5-carbamoyl-2-methylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 23992808) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(5-carbamoyl-2-methylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-carbamoyl-2-methylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 23992808 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(5-carbamoyl-2-methylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(C(N)=O)cc1NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O4/c1-9-2-3-10(15(17)19)6-12(9)18-16(20)11-4-5-13-14(7-11)22-8-21-13/h2-7H,8H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | NYIGOKGUKJAIMQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |