C36H44N4OSn — CID 174525870
N-[4-(benzylamino)-3-cyano-6-tributylstannylquinolin-2-yl]benzamide (PubChem CID 174525870) has the molecular formula C36H44N4OSn and a molecular weight of 667.49 g/mol. Its IUPAC name is N-[4-(benzylamino)-3-cyano-6-tributylstannylquinolin-2-yl]benzamide.
| Compound Name | N-[4-(benzylamino)-3-cyano-6-tributylstannylquinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 174525870 |
| Molecular Formula | C36H44N4OSn |
| Molecular Weight | 667.49 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | N-[4-(benzylamino)-3-cyano-6-tributylstannylquinolin-2-yl]benzamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2nc(NC(=O)c3ccccc3)c(C#N)c(NCc3ccccc3)c2c1 |
| InChI | InChI=1S/C24H17N4O.3C4H9.Sn/c25-15-20-22(26-16-17-9-3-1-4-10-17)19-13-7-8-14-21(19)27-23(20)28-24(29)18-11-5-2-6-12-18;3*1-3-4-2;/h1-6,8-14H,16H2,(H2,26,27,28,29);3*1,3-4H2,2H3; |
| InChIKey | FMLKDTNOEUZXIW-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.49 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |