C19H12N2O3S — CID 40959415
N-benzo[g][1,3]benzothiazol-2-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 40959415) has the molecular formula C19H12N2O3S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 40959415 |
| Molecular Formula | C19H12N2O3S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1nc2ccc3ccccc3c2s1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H12N2O3S/c22-18(12-6-8-15-16(9-12)24-10-23-15)21-19-20-14-7-5-11-3-1-2-4-13(11)17(14)25-19/h1-9H,10H2,(H,20,21,22) |
| InChIKey | BCDNMDDEIBMEAJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |