C15H16N4O — CID 3221668
N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]acetamide (PubChem CID 3221668) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 3221668 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[2-[(3-cyano-7-methylquinolin-2-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc2cc(C)ccc2cc1C#N |
| InChI | InChI=1S/C15H16N4O/c1-10-3-4-12-8-13(9-16)15(19-14(12)7-10)18-6-5-17-11(2)20/h3-4,7-8H,5-6H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | REQZFMCWMOEZOK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|