C20H20N4O4S — CID 44754453
N-[2-[(3-cyano-6-methoxyquinolin-2-yl)amino]ethyl]-4-methoxybenzenesulfonamide (PubChem CID 44754453) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[2-[(3-cyano-6-methoxyquinolin-2-yl)amino]ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[(3-cyano-6-methoxyquinolin-2-yl)amino]ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 44754453 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[2-[(3-cyano-6-methoxyquinolin-2-yl)amino]ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2nc3ccc(OC)cc3cc2C#N)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-27-16-3-6-18(7-4-16)29(25,26)23-10-9-22-20-15(13-21)11-14-12-17(28-2)5-8-19(14)24-20/h3-8,11-12,23H,9-10H2,1-2H3,(H,22,24) |
| InChIKey | GBHAXVUOSWOPPI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|