C20H20N2O6S — CID 7653682
[(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-[(2-cyanophenyl)sulfonylamino]acetate (PubChem CID 7653682) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-[(2-cyanophenyl)sulfonylamino]acetate.
| Compound Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7653682 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [(2R)-1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-[(2-cyanophenyl)sulfonylamino]acetate |
| SMILES | CCOc1ccc(C(=O)[C@@H](C)OC(=O)CNS(=O)(=O)c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-3-27-17-10-8-15(9-11-17)20(24)14(2)28-19(23)13-22-29(25,26)18-7-5-4-6-16(18)12-21/h4-11,14,22H,3,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZLZKFUQBSSGSBX-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |