C9H12N4S3 — CID 133391775
2-methylsulfanyl-N-(2-methylsulfanylethyl)-[1,3]thiazolo[4,5-d]pyrimidin-7-amine (PubChem CID 133391775) has the molecular formula C9H12N4S3 and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(2-methylsulfanylethyl)-[1,3]thiazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 2-methylsulfanyl-N-(2-methylsulfanylethyl)-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133391775 |
| Molecular Formula | C9H12N4S3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-methylsulfanyl-N-(2-methylsulfanylethyl)-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CSCCNc1ncnc2nc(SC)sc12 |
| InChI | InChI=1S/C9H12N4S3/c1-14-4-3-10-7-6-8(12-5-11-7)13-9(15-2)16-6/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | OATJBSOHODJXCR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|