C14H12F4N2O — CID 133370569
2,3,5,6-tetrafluoro-N-[2-(4-methylphenoxy)ethyl]pyridin-4-amine (PubChem CID 133370569) has the molecular formula C14H12F4N2O and a molecular weight of 300.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[2-(4-methylphenoxy)ethyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[2-(4-methylphenoxy)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133370569 |
| Molecular Formula | C14H12F4N2O |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[2-(4-methylphenoxy)ethyl]pyridin-4-amine |
| SMILES | Cc1ccc(OCCNc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C14H12F4N2O/c1-8-2-4-9(5-3-8)21-7-6-19-12-10(15)13(17)20-14(18)11(12)16/h2-5H,6-7H2,1H3,(H,19,20) |
| InChIKey | DTPNJMSXYPCCTP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|