C15H15F2N5O2 — CID 133291787
N-[2-(3,4-difluorophenoxy)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133291787) has the molecular formula C15H15F2N5O2 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133291787 |
| Molecular Formula | C15H15F2N5O2 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COCc1cc(NCCOc2ccc(F)c(F)c2)n2ncnc2n1 |
| InChI | InChI=1S/C15H15F2N5O2/c1-23-8-10-6-14(22-15(21-10)19-9-20-22)18-4-5-24-11-2-3-12(16)13(17)7-11/h2-3,6-7,9,18H,4-5,8H2,1H3 |
| InChIKey | YNWQTUXLRYWYOI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|