C16H23N5O — CID 133477099
N-[2-(cyclohepten-1-yl)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133477099) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[2-(cyclohepten-1-yl)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[2-(cyclohepten-1-yl)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133477099 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[2-(cyclohepten-1-yl)ethyl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COCc1cc(NCCC2=CCCCCC2)n2ncnc2n1 |
| InChI | InChI=1S/C16H23N5O/c1-22-11-14-10-15(21-16(20-14)18-12-19-21)17-9-8-13-6-4-2-3-5-7-13/h6,10,12,17H,2-5,7-9,11H2,1H3 |
| InChIKey | CRRGVIJOLFYRQB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|