C16H17BrN6O2 — CID 133270227
4-bromo-N-[2-[[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]benzamide (PubChem CID 133270227) has the molecular formula C16H17BrN6O2 and a molecular weight of 405.26 g/mol. Its IUPAC name is 4-bromo-N-[2-[[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133270227 |
| Molecular Formula | C16H17BrN6O2 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-bromo-N-[2-[[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]ethyl]benzamide |
| SMILES | COCc1cc(NCCNC(=O)c2ccc(Br)cc2)n2ncnc2n1 |
| InChI | InChI=1S/C16H17BrN6O2/c1-25-9-13-8-14(23-16(22-13)20-10-21-23)18-6-7-19-15(24)11-2-4-12(17)5-3-11/h2-5,8,10,18H,6-7,9H2,1H3,(H,19,24) |
| InChIKey | PFHRUGVXRODFGA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|