C15H20N8O2 — CID 133323129
2-[4-[(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]pyrazol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 133323129) has the molecular formula C15H20N8O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]pyrazol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]pyrazol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 133323129 |
| Molecular Formula | C15H20N8O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[4-[(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]pyrazol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCc1cc(Nc2cnn(CC(=O)NCCOC)c2)n2ncnc2n1 |
| InChI | InChI=1S/C15H20N8O2/c1-3-11-6-13(23-15(21-11)17-10-19-23)20-12-7-18-22(8-12)9-14(24)16-4-5-25-2/h6-8,10,20H,3-5,9H2,1-2H3,(H,16,24) |
| InChIKey | LYQBSRFVFQWIAA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|