C16H18ClN5O2 — CID 133271384
N-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133271384) has the molecular formula C16H18ClN5O2 and a molecular weight of 347.81 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133271384 |
| Molecular Formula | C16H18ClN5O2 |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(Nc2ccc(OCCOC)c(Cl)c2)n2ncnc2n1 |
| InChI | InChI=1S/C16H18ClN5O2/c1-3-11-9-15(22-16(21-11)18-10-19-22)20-12-4-5-14(13(17)8-12)24-7-6-23-2/h4-5,8-10,20H,3,6-7H2,1-2H3 |
| InChIKey | JEOQVXTWXVLABG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|