C17H20F2N6O — CID 133314695
1-(2,6-difluorophenyl)-N'-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylethane-1,2-diamine (PubChem CID 133314695) has the molecular formula C17H20F2N6O and a molecular weight of 362.38 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N'-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | 1-(2,6-difluorophenyl)-N'-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 133314695 |
| Molecular Formula | C17H20F2N6O |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N'-[5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-N,N-dimethylethane-1,2-diamine |
| SMILES | COCc1cc(NCC(c2c(F)cccc2F)N(C)C)n2ncnc2n1 |
| InChI | InChI=1S/C17H20F2N6O/c1-24(2)14(16-12(18)5-4-6-13(16)19)8-20-15-7-11(9-26-3)23-17-21-10-22-25(15)17/h4-7,10,14,20H,8-9H2,1-3H3 |
| InChIKey | JZZAROUONDUPMK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |