C13H12ClF2N3O2 — CID 133291718
4-chloro-5-[2-(3,4-difluorophenoxy)ethylamino]-2-methylpyridazin-3-one (PubChem CID 133291718) has the molecular formula C13H12ClF2N3O2 and a molecular weight of 315.71 g/mol. Its IUPAC name is 4-chloro-5-[2-(3,4-difluorophenoxy)ethylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(3,4-difluorophenoxy)ethylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133291718 |
| Molecular Formula | C13H12ClF2N3O2 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-chloro-5-[2-(3,4-difluorophenoxy)ethylamino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCCOc2ccc(F)c(F)c2)c(Cl)c1=O |
| InChI | InChI=1S/C13H12ClF2N3O2/c1-19-13(20)12(14)11(7-18-19)17-4-5-21-8-2-3-9(15)10(16)6-8/h2-3,6-7,17H,4-5H2,1H3 |
| InChIKey | OCONGEFQQRKTFU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|