C13H21ClN4O2 — CID 114445249
5-[2-(4-aminocyclohexyl)oxyethylamino]-4-chloro-2-methylpyridazin-3-one (PubChem CID 114445249) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 5-[2-(4-aminocyclohexyl)oxyethylamino]-4-chloro-2-methylpyridazin-3-one.
| Compound Name | 5-[2-(4-aminocyclohexyl)oxyethylamino]-4-chloro-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 114445249 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-[2-(4-aminocyclohexyl)oxyethylamino]-4-chloro-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCCOC2CCC(N)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C13H21ClN4O2/c1-18-13(19)12(14)11(8-17-18)16-6-7-20-10-4-2-9(15)3-5-10/h8-10,16H,2-7,15H2,1H3 |
| InChIKey | SPXWPPRJRLDVRS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|