C12H16F3NO2 — CID 114127447
2-[2-(2,2-difluoroethoxy)ethylamino]-1-(2-fluorophenyl)ethanol (PubChem CID 114127447) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethylamino]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethylamino]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 114127447 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethylamino]-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CNCCOCC(F)F)c1ccccc1F |
| InChI | InChI=1S/C12H16F3NO2/c13-10-4-2-1-3-9(10)11(17)7-16-5-6-18-8-12(14)15/h1-4,11-12,16-17H,5-8H2 |
| InChIKey | XKICJSFFWOYREE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|