C12H17F2NO2 — CID 54937805
1-(2,4-difluorophenyl)-2-(2-ethoxyethylamino)ethanol (PubChem CID 54937805) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2-ethoxyethylamino)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2-ethoxyethylamino)ethanol |
|---|---|
| PubChem CID | 54937805 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2-ethoxyethylamino)ethanol |
| SMILES | CCOCCNCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H17F2NO2/c1-2-17-6-5-15-8-12(16)10-4-3-9(13)7-11(10)14/h3-4,7,12,15-16H,2,5-6,8H2,1H3 |
| InChIKey | GONLYDVKWQKGQJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|