C13H19F2NO3 — CID 106246645
4-[[2-(2,4-difluorophenyl)-2-hydroxyethyl]amino]-1-methoxybutan-2-ol (PubChem CID 106246645) has the molecular formula C13H19F2NO3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 4-[[2-(2,4-difluorophenyl)-2-hydroxyethyl]amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[[2-(2,4-difluorophenyl)-2-hydroxyethyl]amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106246645 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-[[2-(2,4-difluorophenyl)-2-hydroxyethyl]amino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2NO3/c1-19-8-10(17)4-5-16-7-13(18)11-3-2-9(14)6-12(11)15/h2-3,6,10,13,16-18H,4-5,7-8H2,1H3 |
| InChIKey | SWIPADWRGRRGER-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|