C14H22F2N2O2 — CID 62842752
1-(2,4-difluorophenyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]ethanol (PubChem CID 62842752) has the molecular formula C14H22F2N2O2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 62842752 |
| Molecular Formula | C14H22F2N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]ethanol |
| SMILES | COCCN(C)CCNCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H22F2N2O2/c1-18(7-8-20-2)6-5-17-10-14(19)12-4-3-11(15)9-13(12)16/h3-4,9,14,17,19H,5-8,10H2,1-2H3 |
| InChIKey | DNCXZMDIECAULP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|