C13H20BrFN2 — CID 113410278
N-[(2-bromo-3-fluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 113410278) has the molecular formula C13H20BrFN2 and a molecular weight of 303.22 g/mol. Its IUPAC name is N-[(2-bromo-3-fluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-[(2-bromo-3-fluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 113410278 |
| Molecular Formula | C13H20BrFN2 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[(2-bromo-3-fluorophenyl)methyl]-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)NCCCNCc1cccc(F)c1Br |
| InChI | InChI=1S/C13H20BrFN2/c1-10(2)17-8-4-7-16-9-11-5-3-6-12(15)13(11)14/h3,5-6,10,16-17H,4,7-9H2,1-2H3 |
| InChIKey | BUSLFWWDGDVPCC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|