C12H17Br2NO2 — CID 62599508
3-(2,6-dibromophenoxy)-N-(2-methoxyethyl)propan-1-amine (PubChem CID 62599508) has the molecular formula C12H17Br2NO2 and a molecular weight of 367.08 g/mol. Its IUPAC name is 3-(2,6-dibromophenoxy)-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-(2,6-dibromophenoxy)-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 62599508 |
| Molecular Formula | C12H17Br2NO2 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | 3-(2,6-dibromophenoxy)-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCCCOc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H17Br2NO2/c1-16-9-7-15-6-3-8-17-12-10(13)4-2-5-11(12)14/h2,4-5,15H,3,6-9H2,1H3 |
| InChIKey | LDFZWAGMSARYDB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|