C14H22BrNO3 — CID 55219306
N-[[3-bromo-2-(2-ethoxyethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 55219306) has the molecular formula C14H22BrNO3 and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[[3-bromo-2-(2-ethoxyethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-bromo-2-(2-ethoxyethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 55219306 |
| Molecular Formula | C14H22BrNO3 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[[3-bromo-2-(2-ethoxyethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | CCOCCOc1c(Br)cccc1CNCCOC |
| InChI | InChI=1S/C14H22BrNO3/c1-3-18-9-10-19-14-12(5-4-6-13(14)15)11-16-7-8-17-2/h4-6,16H,3,7-11H2,1-2H3 |
| InChIKey | MZTOYENIZRSWEF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|