C15H17Br2NO2S — CID 63059944
N-[[3-bromo-2-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methoxyethanamine (PubChem CID 63059944) has the molecular formula C15H17Br2NO2S and a molecular weight of 435.18 g/mol. Its IUPAC name is N-[[3-bromo-2-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-bromo-2-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63059944 |
| Molecular Formula | C15H17Br2NO2S |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | N-[[3-bromo-2-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccc(Br)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C15H17Br2NO2S/c1-19-6-5-18-8-11-3-2-4-14(17)15(11)20-9-13-7-12(16)10-21-13/h2-4,7,10,18H,5-6,8-9H2,1H3 |
| InChIKey | RHTRVPCCZKCYER-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|