C15H18BrNO2S — CID 63060308
N-[[3-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63060308) has the molecular formula C15H18BrNO2S and a molecular weight of 356.29 g/mol. Its IUPAC name is N-[[3-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63060308 |
| Molecular Formula | C15H18BrNO2S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[[3-bromo-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccc(Br)c1OCc1cccs1 |
| InChI | InChI=1S/C15H18BrNO2S/c1-18-8-7-17-10-12-4-2-6-14(16)15(12)19-11-13-5-3-9-20-13/h2-6,9,17H,7-8,10-11H2,1H3 |
| InChIKey | SXDFKSATTQCWFW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|