C15H18Cl2N2 — CID 82449312
N-[(7,8-dichloro-2-methylquinolin-4-yl)methyl]butan-2-amine (PubChem CID 82449312) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is N-[(7,8-dichloro-2-methylquinolin-4-yl)methyl]butan-2-amine.
| Compound Name | N-[(7,8-dichloro-2-methylquinolin-4-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 82449312 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(7,8-dichloro-2-methylquinolin-4-yl)methyl]butan-2-amine |
| SMILES | CCC(C)NCc1cc(C)nc2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C15H18Cl2N2/c1-4-9(2)18-8-11-7-10(3)19-15-12(11)5-6-13(16)14(15)17/h5-7,9,18H,4,8H2,1-3H3 |
| InChIKey | RHXFIKGMGQIWOH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |