C12H11Cl2NO — CID 82576061
1-(7,8-dichloro-2-methylquinolin-4-yl)ethanol (PubChem CID 82576061) has the molecular formula C12H11Cl2NO and a molecular weight of 256.13 g/mol. Its IUPAC name is 1-(7,8-dichloro-2-methylquinolin-4-yl)ethanol.
| Compound Name | 1-(7,8-dichloro-2-methylquinolin-4-yl)ethanol |
|---|---|
| PubChem CID | 82576061 |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 1-(7,8-dichloro-2-methylquinolin-4-yl)ethanol |
| SMILES | Cc1cc(C(C)O)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C12H11Cl2NO/c1-6-5-9(7(2)16)8-3-4-10(13)11(14)12(8)15-6/h3-5,7,16H,1-2H3 |
| InChIKey | ISSQONWHLRIIMD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |