C11H7Cl2NO — CID 82449304
7,8-dichloro-2-methylquinoline-4-carbaldehyde (PubChem CID 82449304) has the molecular formula C11H7Cl2NO and a molecular weight of 240.09 g/mol. Its IUPAC name is 7,8-dichloro-2-methylquinoline-4-carbaldehyde.
| Compound Name | 7,8-dichloro-2-methylquinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 82449304 |
| Molecular Formula | C11H7Cl2NO |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 7,8-dichloro-2-methylquinoline-4-carbaldehyde |
| SMILES | Cc1cc(C=O)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C11H7Cl2NO/c1-6-4-7(5-15)8-2-3-9(12)10(13)11(8)14-6/h2-5H,1H3 |
| InChIKey | LWVXTGLKQHGJMM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|