C9H11NO2 — CID 84652102
3-methoxy-2,6-dimethylpyridine-4-carbaldehyde (PubChem CID 84652102) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-methoxy-2,6-dimethylpyridine-4-carbaldehyde.
| Compound Name | 3-methoxy-2,6-dimethylpyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 84652102 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-methoxy-2,6-dimethylpyridine-4-carbaldehyde |
| SMILES | COc1c(C=O)cc(C)nc1C |
| InChI | InChI=1S/C9H11NO2/c1-6-4-8(5-11)9(12-3)7(2)10-6/h4-5H,1-3H3 |
| InChIKey | PIDDEJZOCMOFQY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|