C14H27NO — CID 144795735
ethane;4-ethyl-3-methoxy-2,6-dimethylpyridine (PubChem CID 144795735) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;4-ethyl-3-methoxy-2,6-dimethylpyridine.
| Compound Name | ethane;4-ethyl-3-methoxy-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 144795735 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | ethane;4-ethyl-3-methoxy-2,6-dimethylpyridine |
| SMILES | CC.CC.CCc1cc(C)nc(C)c1OC |
| InChI | InChI=1S/C10H15NO.2C2H6/c1-5-9-6-7(2)11-8(3)10(9)12-4;2*1-2/h6H,5H2,1-4H3;2*1-2H3 |
| InChIKey | HMCMZYMXLMMDHB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |