C15H17Cl2NO — CID 82449344
2-(7,8-dichloro-2-propan-2-ylquinolin-4-yl)propan-2-ol (PubChem CID 82449344) has the molecular formula C15H17Cl2NO and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-(7,8-dichloro-2-propan-2-ylquinolin-4-yl)propan-2-ol.
| Compound Name | 2-(7,8-dichloro-2-propan-2-ylquinolin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 82449344 |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-(7,8-dichloro-2-propan-2-ylquinolin-4-yl)propan-2-ol |
| SMILES | CC(C)c1cc(C(C)(C)O)c2ccc(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C15H17Cl2NO/c1-8(2)12-7-10(15(3,4)19)9-5-6-11(16)13(17)14(9)18-12/h5-8,19H,1-4H3 |
| InChIKey | YRSBTGLZIOJWFO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |