C14H16Cl2N2 — CID 63524899
7,8-dichloro-N-ethyl-3-propan-2-ylquinolin-2-amine (PubChem CID 63524899) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 7,8-dichloro-N-ethyl-3-propan-2-ylquinolin-2-amine.
| Compound Name | 7,8-dichloro-N-ethyl-3-propan-2-ylquinolin-2-amine |
|---|---|
| PubChem CID | 63524899 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 7,8-dichloro-N-ethyl-3-propan-2-ylquinolin-2-amine |
| SMILES | CCNc1nc2c(Cl)c(Cl)ccc2cc1C(C)C |
| InChI | InChI=1S/C14H16Cl2N2/c1-4-17-14-10(8(2)3)7-9-5-6-11(15)12(16)13(9)18-14/h5-8H,4H2,1-3H3,(H,17,18) |
| InChIKey | WHBUENNMYVZKEA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |