C11H16Cl3N — CID 17293997
N-[(3,4-dichlorophenyl)methyl]butan-2-amine;hydrochloride (PubChem CID 17293997) has the molecular formula C11H16Cl3N and a molecular weight of 268.62 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17293997 |
| Molecular Formula | C11H16Cl3N |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H15Cl2N.ClH/c1-3-8(2)14-7-9-4-5-10(12)11(13)6-9;/h4-6,8,14H,3,7H2,1-2H3;1H |
| InChIKey | NLIKEELCQMXRRK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |