C10H12BrCl2N — CID 107859511
1-bromo-N-[(3,4-dichlorophenyl)methyl]propan-2-amine (PubChem CID 107859511) has the molecular formula C10H12BrCl2N and a molecular weight of 297.02 g/mol. Its IUPAC name is 1-bromo-N-[(3,4-dichlorophenyl)methyl]propan-2-amine.
| Compound Name | 1-bromo-N-[(3,4-dichlorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107859511 |
| Molecular Formula | C10H12BrCl2N |
| Molecular Weight | 297.02 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 1-bromo-N-[(3,4-dichlorophenyl)methyl]propan-2-amine |
| SMILES | CC(CBr)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12BrCl2N/c1-7(5-11)14-6-8-2-3-9(12)10(13)4-8/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | JAPOYUQJHVNYPR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.02 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|