C12H13Cl2N — CID 115660206
N-[(3,4-dichlorophenyl)methyl]pent-4-yn-2-amine (PubChem CID 115660206) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]pent-4-yn-2-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115660206 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N/c1-3-4-9(2)15-8-10-5-6-11(13)12(14)7-10/h1,5-7,9,15H,4,8H2,2H3 |
| InChIKey | JPXCBRIZCCCDID-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|