C12H13ClN2O2 — CID 115660183
N-[(4-chloro-3-nitrophenyl)methyl]pent-4-yn-2-amine (PubChem CID 115660183) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methyl]pent-4-yn-2-amine.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115660183 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-3-4-9(2)14-8-10-5-6-11(13)12(7-10)15(16)17/h1,5-7,9,14H,4,8H2,2H3 |
| InChIKey | ONKLSHKMSKCWAZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|