C15H21NO — CID 145015199
ethane;2,4,6,8-tetramethylquinolin-7-ol (PubChem CID 145015199) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;2,4,6,8-tetramethylquinolin-7-ol.
| Compound Name | ethane;2,4,6,8-tetramethylquinolin-7-ol |
|---|---|
| PubChem CID | 145015199 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethane;2,4,6,8-tetramethylquinolin-7-ol |
| SMILES | CC.Cc1cc(C)c2cc(C)c(O)c(C)c2n1 |
| InChI | InChI=1S/C13H15NO.C2H6/c1-7-5-9(3)14-12-10(4)13(15)8(2)6-11(7)12;1-2/h5-6,15H,1-4H3;1-2H3 |
| InChIKey | LWGOQWRMLBADNV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |