C12H12FNO — CID 82576373
(8-fluoro-2,4-dimethylquinolin-6-yl)methanol (PubChem CID 82576373) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is (8-fluoro-2,4-dimethylquinolin-6-yl)methanol.
| Compound Name | (8-fluoro-2,4-dimethylquinolin-6-yl)methanol |
|---|---|
| PubChem CID | 82576373 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (8-fluoro-2,4-dimethylquinolin-6-yl)methanol |
| SMILES | Cc1cc(C)c2cc(CO)cc(F)c2n1 |
| InChI | InChI=1S/C12H12FNO/c1-7-3-8(2)14-12-10(7)4-9(6-15)5-11(12)13/h3-5,15H,6H2,1-2H3 |
| InChIKey | GKAGNHINDPDUDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |