C22H18F2N2O3 — CID 159119849
8-fluoro-2-methylquinoline-4-carboxylic acid;(8-fluoro-2-methylquinolin-4-yl)methanol (PubChem CID 159119849) has the molecular formula C22H18F2N2O3 and a molecular weight of 396.39 g/mol. Its IUPAC name is 8-fluoro-2-methylquinoline-4-carboxylic acid;(8-fluoro-2-methylquinolin-4-yl)methanol.
| Compound Name | 8-fluoro-2-methylquinoline-4-carboxylic acid;(8-fluoro-2-methylquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 159119849 |
| Molecular Formula | C22H18F2N2O3 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 8-fluoro-2-methylquinoline-4-carboxylic acid;(8-fluoro-2-methylquinolin-4-yl)methanol |
| SMILES | Cc1cc(C(=O)O)c2cccc(F)c2n1.Cc1cc(CO)c2cccc(F)c2n1 |
| InChI | InChI=1S/C11H8FNO2.C11H10FNO/c1-6-5-8(11(14)15)7-3-2-4-9(12)10(7)13-6;1-7-5-8(6-14)9-3-2-4-10(12)11(9)13-7/h2-5H,1H3,(H,14,15);2-5,14H,6H2,1H3 |
| InChIKey | KFOAKAPTDAOCCU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |