C15H17FN2O — CID 110489286
N,N-diethyl-8-fluoro-2-methylquinoline-4-carboxamide (PubChem CID 110489286) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is N,N-diethyl-8-fluoro-2-methylquinoline-4-carboxamide.
| Compound Name | N,N-diethyl-8-fluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 110489286 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N,N-diethyl-8-fluoro-2-methylquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C)nc2c(F)cccc12 |
| InChI | InChI=1S/C15H17FN2O/c1-4-18(5-2)15(19)12-9-10(3)17-14-11(12)7-6-8-13(14)16/h6-9H,4-5H2,1-3H3 |
| InChIKey | ANQJYUYVZBLGRD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |