C12H16ClN5O2 — CID 66542076
N-[(2-chloro-4,5-diethoxyphenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 66542076) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is N-[(2-chloro-4,5-diethoxyphenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 66542076 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | CCOc1cc(Cl)c(CNc2nn[nH]n2)cc1OCC |
| InChI | InChI=1S/C12H16ClN5O2/c1-3-19-10-5-8(7-14-12-15-17-18-16-12)9(13)6-11(10)20-4-2/h5-6H,3-4,7H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | FBTKPNXWNAJTRU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |