C11H14BrN5O2 — CID 66543142
N-[(2-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 66543142) has the molecular formula C11H14BrN5O2 and a molecular weight of 328.17 g/mol. Its IUPAC name is N-[(2-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(2-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 66543142 |
| Molecular Formula | C11H14BrN5O2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-[(2-bromo-4-ethoxy-5-methoxyphenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | CCOc1cc(Br)c(CNc2nn[nH]n2)cc1OC |
| InChI | InChI=1S/C11H14BrN5O2/c1-3-19-10-5-8(12)7(4-9(10)18-2)6-13-11-14-16-17-15-11/h4-5H,3,6H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | JFFRMVZFNHSRQK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |