C11H15N5O3 — CID 4726696
N-[(2,4,5-trimethoxyphenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 4726696) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 4726696 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | COc1cc(OC)c(OC)cc1CNc1nn[nH]n1 |
| InChI | InChI=1S/C11H15N5O3/c1-17-8-5-10(19-3)9(18-2)4-7(8)6-12-11-13-15-16-14-11/h4-5H,6H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | HEQJHVNODAIENL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |