C7H6FN5 — CID 130013830
N-(3-fluorophenyl)-2H-tetrazol-5-amine (PubChem CID 130013830) has the molecular formula C7H6FN5 and a molecular weight of 179.16 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2H-tetrazol-5-amine.
| Compound Name | N-(3-fluorophenyl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 130013830 |
| Molecular Formula | C7H6FN5 |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N-(3-fluorophenyl)-2H-tetrazol-5-amine |
| SMILES | Fc1cccc(Nc2nn[nH]n2)c1 |
| InChI | InChI=1S/C7H6FN5/c8-5-2-1-3-6(4-5)9-7-10-12-13-11-7/h1-4H,(H2,9,10,11,12,13) |
| InChIKey | HLADYAXMGXRSJG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |