C8H5BrFN3S — CID 64622828
5-bromo-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64622828) has the molecular formula C8H5BrFN3S and a molecular weight of 274.12 g/mol. Its IUPAC name is 5-bromo-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64622828 |
| Molecular Formula | C8H5BrFN3S |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | 5-bromo-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1cccc(Nc2nnc(Br)s2)c1 |
| InChI | InChI=1S/C8H5BrFN3S/c9-7-12-13-8(14-7)11-6-3-1-2-5(10)4-6/h1-4H,(H,11,13) |
| InChIKey | KZNNCYTWQOIQEK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |