C12H14FN3OS2 — CID 8674010
5-(2-ethoxyethylsulfanyl)-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 8674010) has the molecular formula C12H14FN3OS2 and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(2-ethoxyethylsulfanyl)-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-ethoxyethylsulfanyl)-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 8674010 |
| Molecular Formula | C12H14FN3OS2 |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-(2-ethoxyethylsulfanyl)-N-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOCCSc1nnc(Nc2cccc(F)c2)s1 |
| InChI | InChI=1S/C12H14FN3OS2/c1-2-17-6-7-18-12-16-15-11(19-12)14-10-5-3-4-9(13)8-10/h3-5,8H,2,6-7H2,1H3,(H,14,15) |
| InChIKey | LLBMWPNATNBYHZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|