C18H16FN3O3S2 — CID 8972430
(4-ethoxyphenyl) 2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 8972430) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is (4-ethoxyphenyl) 2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (4-ethoxyphenyl) 2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 8972430 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (4-ethoxyphenyl) 2-[[5-(3-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOc1ccc(OC(=O)CSc2nnc(Nc3cccc(F)c3)s2)cc1 |
| InChI | InChI=1S/C18H16FN3O3S2/c1-2-24-14-6-8-15(9-7-14)25-16(23)11-26-18-22-21-17(27-18)20-13-5-3-4-12(19)10-13/h3-10H,2,11H2,1H3,(H,20,21) |
| InChIKey | NGOXZBLEWNPSGG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|