C9H8FN3S — CID 102767447
2-N-(3-fluorophenyl)-1,3-thiazole-2,5-diamine (PubChem CID 102767447) has the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-N-(3-fluorophenyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(3-fluorophenyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102767447 |
| Molecular Formula | C9H8FN3S |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-N-(3-fluorophenyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(Nc2cccc(F)c2)s1 |
| InChI | InChI=1S/C9H8FN3S/c10-6-2-1-3-7(4-6)13-9-12-5-8(11)14-9/h1-5H,11H2,(H,12,13) |
| InChIKey | PIYGLWMXOUERNX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |