C11H13N3S — CID 82059164
4-methyl-1-N-(5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine (PubChem CID 82059164) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-methyl-1-N-(5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-(5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 82059164 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-methyl-1-N-(5-methyl-1,3-thiazol-2-yl)benzene-1,3-diamine |
| SMILES | Cc1cnc(Nc2ccc(C)c(N)c2)s1 |
| InChI | InChI=1S/C11H13N3S/c1-7-3-4-9(5-10(7)12)14-11-13-6-8(2)15-11/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | XOHMGZARSUDIOH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|