C8H9N5S — CID 116796301
2-N-(5-methyl-1,3-thiazol-2-yl)pyrimidine-2,4-diamine (PubChem CID 116796301) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-N-(5-methyl-1,3-thiazol-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-methyl-1,3-thiazol-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796301 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-N-(5-methyl-1,3-thiazol-2-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2nccc(N)n2)s1 |
| InChI | InChI=1S/C8H9N5S/c1-5-4-11-8(14-5)13-7-10-3-2-6(9)12-7/h2-4H,1H3,(H3,9,10,11,12,13) |
| InChIKey | PNHQUBORHSDWCR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |